C33H49N3 — CID 100991688
2-[7-(dioctylamino)-4,4a,5,6,10,10a-hexahydro-3H-anthracen-2-ylidene]propanedinitrile (PubChem CID 100991688) has the molecular formula C33H49N3 and a molecular weight of 487.78 g/mol. Its IUPAC name is 2-[7-(dioctylamino)-4,4a,5,6,10,10a-hexahydro-3H-anthracen-2-ylidene]propanedinitrile.
| Compound Name | 2-[7-(dioctylamino)-4,4a,5,6,10,10a-hexahydro-3H-anthracen-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 100991688 |
| Molecular Formula | C33H49N3 |
| Molecular Weight | 487.78 g/mol |
| Exact Mass | 487.39 |
| IUPAC Name | 2-[7-(dioctylamino)-4,4a,5,6,10,10a-hexahydro-3H-anthracen-2-ylidene]propanedinitrile |
| SMILES | CCCCCCCCN(CCCCCCCC)C1=CC2=CC3=CC(=C(C#N)C#N)CCC3CC2CC1 |
| InChI | InChI=1S/C33H49N3/c1-3-5-7-9-11-13-19-36(20-14-12-10-8-6-4-2)33-18-17-28-21-27-15-16-29(32(25-34)26-35)22-30(27)23-31(28)24-33/h22-24,27-28H,3-21H2,1-2H3 |
| InChIKey | AVASGCHKTVGRFS-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.78 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|