C17H28O4 — CID 100992168
[(2E,6E,10S)-8,10-dihydroxy-2,6,10-trimethyldodeca-2,6,11-trienyl] acetate (PubChem CID 100992168) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is [(2E,6E,10S)-8,10-dihydroxy-2,6,10-trimethyldodeca-2,6,11-trienyl] acetate.
| Compound Name | [(2E,6E,10S)-8,10-dihydroxy-2,6,10-trimethyldodeca-2,6,11-trienyl] acetate |
|---|---|
| PubChem CID | 100992168 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | [(2E,6E,10S)-8,10-dihydroxy-2,6,10-trimethyldodeca-2,6,11-trienyl] acetate |
| SMILES | C=C[C@@](C)(O)CC(O)/C=C(\C)CC/C=C(\C)COC(C)=O |
| InChI | InChI=1S/C17H28O4/c1-6-17(5,20)11-16(19)10-13(2)8-7-9-14(3)12-21-15(4)18/h6,9-10,16,19-20H,1,7-8,11-12H2,2-5H3/b13-10+,14-9+/t16?,17-/m1/s1 |
| InChIKey | RWIWWVYFTIGTBC-JBHUTGSLSA-N |
| XLogP | 2.91 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|