About (7-methyl-3,11,14-trithiabicyclo[5.5.5]heptadecan-1-yl)methanol
(7-methyl-3,11,14-trithiabicyclo[5.5.5]heptadecan-1-yl)methanol (PubChem CID 100992275) has the molecular formula C16H30OS3
and a molecular weight of 334.62 g/mol. Its IUPAC name is (7-methyl-3,11,14-trithiabicyclo[5.5.5]heptadecan-1-yl)methanol.
Molecular Properties
| Compound Name | (7-methyl-3,11,14-trithiabicyclo[5.5.5]heptadecan-1-yl)methanol |
| PubChem CID | 100992275 |
| Molecular Formula | C16H30OS3 |
| Molecular Weight | 334.62 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (7-methyl-3,11,14-trithiabicyclo[5.5.5]heptadecan-1-yl)methanol |
| SMILES | CC12CCCSCC(CO)(CSCCC1)CSCCC2 |
| InChI | InChI=1S/C16H30OS3/c1-15-5-2-8-18-12-16(11-17,13-19-9-3-6-15)14-20-10-4-7-15/h17H,2-14H2,1H3 |
| InChIKey | QWRACVOFGBMZID-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7-methyl-3,11,14-trithiabicyclo[5.5.5]heptadecan-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methyl-3,11,14-trithiabicyclo[5.5.5]heptadecan-1-yl)methanol?
The IUPAC name of (7-methyl-3,11,14-trithiabicyclo[5.5.5]heptadecan-1-yl)methanol (CID 100992275) is (7-methyl-3,11,14-trithiabicyclo[5.5.5]heptadecan-1-yl)methanol.
What is the SMILES notation for (7-methyl-3,11,14-trithiabicyclo[5.5.5]heptadecan-1-yl)methanol?
The canonical SMILES for (7-methyl-3,11,14-trithiabicyclo[5.5.5]heptadecan-1-yl)methanol is CC12CCCSCC(CO)(CSCCC1)CSCCC2.
What is the InChIKey of (7-methyl-3,11,14-trithiabicyclo[5.5.5]heptadecan-1-yl)methanol?
The InChIKey is QWRACVOFGBMZID-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30OS3/c1-15-5-2-8-18-12-16(11-17,13-19-9-3-6-15)14-20-10-4-7-15/h17H,2-14H2,1H3.
What are the key properties of (7-methyl-3,11,14-trithiabicyclo[5.5.5]heptadecan-1-yl)methanol?
(7-methyl-3,11,14-trithiabicyclo[5.5.5]heptadecan-1-yl)methanol has a molecular weight of 334.62 g/mol, XLogP of 4.54, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methyl-3,11,14-trithiabicyclo[5.5.5]heptadecan-1-yl)methanol is sourced from PubChem (CID 100992275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).