About (9aR,9bS)-8-propyl-9a,9b-dihydrobenzo[e][1]benzofuran
(9aR,9bS)-8-propyl-9a,9b-dihydrobenzo[e][1]benzofuran (PubChem CID 100992450) has the molecular formula C15H16O
and a molecular weight of 212.29 g/mol. Its IUPAC name is (9aR,9bS)-8-propyl-9a,9b-dihydrobenzo[e][1]benzofuran.
Molecular Properties
| Compound Name | (9aR,9bS)-8-propyl-9a,9b-dihydrobenzo[e][1]benzofuran |
| PubChem CID | 100992450 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (9aR,9bS)-8-propyl-9a,9b-dihydrobenzo[e][1]benzofuran |
| SMILES | CCCC1=C[C@H]2C(=CC=C3OC=C[C@@H]32)C=C1 |
| InChI | InChI=1S/C15H16O/c1-2-3-11-4-5-12-6-7-15-13(8-9-16-15)14(12)10-11/h4-10,13-14H,2-3H2,1H3/t13-,14+/m1/s1 |
| InChIKey | SCPQFAMTKFEYLV-KGLIPLIRSA-N |
| XLogP | 3.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (9aR,9bS)-8-propyl-9a,9b-dihydrobenzo[e][1]benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9aR,9bS)-8-propyl-9a,9b-dihydrobenzo[e][1]benzofuran?
The IUPAC name of (9aR,9bS)-8-propyl-9a,9b-dihydrobenzo[e][1]benzofuran (CID 100992450) is (9aR,9bS)-8-propyl-9a,9b-dihydrobenzo[e][1]benzofuran.
What is the SMILES notation for (9aR,9bS)-8-propyl-9a,9b-dihydrobenzo[e][1]benzofuran?
The canonical SMILES for (9aR,9bS)-8-propyl-9a,9b-dihydrobenzo[e][1]benzofuran is CCCC1=C[C@H]2C(=CC=C3OC=C[C@@H]32)C=C1.
What is the InChIKey of (9aR,9bS)-8-propyl-9a,9b-dihydrobenzo[e][1]benzofuran?
The InChIKey is SCPQFAMTKFEYLV-KGLIPLIRSA-N. The full InChI is InChI=1S/C15H16O/c1-2-3-11-4-5-12-6-7-15-13(8-9-16-15)14(12)10-11/h4-10,13-14H,2-3H2,1H3/t13-,14+/m1/s1.
What are the key properties of (9aR,9bS)-8-propyl-9a,9b-dihydrobenzo[e][1]benzofuran?
(9aR,9bS)-8-propyl-9a,9b-dihydrobenzo[e][1]benzofuran has a molecular weight of 212.29 g/mol, XLogP of 3.88, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (9aR,9bS)-8-propyl-9a,9b-dihydrobenzo[e][1]benzofuran is sourced from PubChem (CID 100992450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).