C18H26O8 — CID 100992948
1-O,4-O-diethyl 2-O,3-O-dipropan-2-yl (3S,4S)-cyclobutene-1,2,3,4-tetracarboxylate (PubChem CID 100992948) has the molecular formula C18H26O8 and a molecular weight of 370.40 g/mol. Its IUPAC name is 1-O,4-O-diethyl 2-O,3-O-dipropan-2-yl (3S,4S)-cyclobutene-1,2,3,4-tetracarboxylate.
| Compound Name | 1-O,4-O-diethyl 2-O,3-O-dipropan-2-yl (3S,4S)-cyclobutene-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 100992948 |
| Molecular Formula | C18H26O8 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 1-O,4-O-diethyl 2-O,3-O-dipropan-2-yl (3S,4S)-cyclobutene-1,2,3,4-tetracarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OC(C)C)[C@@H](C(=O)OC(C)C)[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C18H26O8/c1-7-23-15(19)11-12(16(20)24-8-2)14(18(22)26-10(5)6)13(11)17(21)25-9(3)4/h9-11,13H,7-8H2,1-6H3/t11-,13+/m1/s1 |
| InChIKey | WPAOWRTYFOKSBX-YPMHNXCESA-N |
| XLogP | 1.56 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|