C15H23FN2O16P2 — CID 100993015
[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3R,4S,5R,6S)-6-(fluoromethyl)-3,4,5-trihydroxyoxan-2-yl] hydrogen phosphate (PubChem CID 100993015) has the molecular formula C15H23FN2O16P2 and a molecular weight of 568.29 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3R,4S,5R,6S)-6-(fluoromethyl)-3,4,5-trihydroxyoxan-2-yl] hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3R,4S,5R,6S)-6-(fluoromethyl)-3,4,5-trihydroxyoxan-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 100993015 |
| Molecular Formula | C15H23FN2O16P2 |
| Molecular Weight | 568.29 g/mol |
| Exact Mass | 568.05 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3R,4S,5R,6S)-6-(fluoromethyl)-3,4,5-trihydroxyoxan-2-yl] hydrogen phosphate |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CF)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C15H23FN2O16P2/c16-3-5-8(20)10(22)12(24)14(32-5)33-36(28,29)34-35(26,27)30-4-6-9(21)11(23)13(31-6)18-2-1-7(19)17-15(18)25/h1-2,5-6,8-14,20-24H,3-4H2,(H,26,27)(H,28,29)(H,17,19,25)/t5-,6-,8+,9-,10+,11-,12-,13-,14-/m1/s1 |
| InChIKey | WTHZQTISDQXDPM-ABVWGUQPSA-N |
| XLogP | -3.82 |
| TPSA | 276.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.29 |
| LogP ≤ 5 | -3.82 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|