About 2-(3-but-3-enyl-2,2-dimethyl-1-trimethylsilyloxycyclohex-3-en-1-yl)acetonitrile oxide
2-(3-but-3-enyl-2,2-dimethyl-1-trimethylsilyloxycyclohex-3-en-1-yl)acetonitrile oxide (PubChem CID 100993183) has the molecular formula C17H29NO2Si
and a molecular weight of 307.51 g/mol. Its IUPAC name is 2-(3-but-3-enyl-2,2-dimethyl-1-trimethylsilyloxycyclohex-3-en-1-yl)acetonitrile oxide.
Molecular Properties
| Compound Name | 2-(3-but-3-enyl-2,2-dimethyl-1-trimethylsilyloxycyclohex-3-en-1-yl)acetonitrile oxide |
| PubChem CID | 100993183 |
| Molecular Formula | C17H29NO2Si |
| Molecular Weight | 307.51 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 2-(3-but-3-enyl-2,2-dimethyl-1-trimethylsilyloxycyclohex-3-en-1-yl)acetonitrile oxide |
| SMILES | C=CCCC1=CCCC(CC#[N+][O-])(O[Si](C)(C)C)C1(C)C |
| InChI | InChI=1S/C17H29NO2Si/c1-7-8-10-15-11-9-12-17(13-14-18-19,16(15,2)3)20-21(4,5)6/h7,11H,1,8-10,12-13H2,2-6H3 |
| InChIKey | LNCIQKICUMAELY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 36.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.51 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-but-3-enyl-2,2-dimethyl-1-trimethylsilyloxycyclohex-3-en-1-yl)acetonitrile oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-but-3-enyl-2,2-dimethyl-1-trimethylsilyloxycyclohex-3-en-1-yl)acetonitrile oxide?
The IUPAC name of 2-(3-but-3-enyl-2,2-dimethyl-1-trimethylsilyloxycyclohex-3-en-1-yl)acetonitrile oxide (CID 100993183) is 2-(3-but-3-enyl-2,2-dimethyl-1-trimethylsilyloxycyclohex-3-en-1-yl)acetonitrile oxide.
What is the SMILES notation for 2-(3-but-3-enyl-2,2-dimethyl-1-trimethylsilyloxycyclohex-3-en-1-yl)acetonitrile oxide?
The canonical SMILES for 2-(3-but-3-enyl-2,2-dimethyl-1-trimethylsilyloxycyclohex-3-en-1-yl)acetonitrile oxide is C=CCCC1=CCCC(CC#[N+][O-])(O[Si](C)(C)C)C1(C)C.
What is the InChIKey of 2-(3-but-3-enyl-2,2-dimethyl-1-trimethylsilyloxycyclohex-3-en-1-yl)acetonitrile oxide?
The InChIKey is LNCIQKICUMAELY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29NO2Si/c1-7-8-10-15-11-9-12-17(13-14-18-19,16(15,2)3)20-21(4,5)6/h7,11H,1,8-10,12-13H2,2-6H3.
What are the key properties of 2-(3-but-3-enyl-2,2-dimethyl-1-trimethylsilyloxycyclohex-3-en-1-yl)acetonitrile oxide?
2-(3-but-3-enyl-2,2-dimethyl-1-trimethylsilyloxycyclohex-3-en-1-yl)acetonitrile oxide has a molecular weight of 307.51 g/mol, XLogP of 5.51, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-but-3-enyl-2,2-dimethyl-1-trimethylsilyloxycyclohex-3-en-1-yl)acetonitrile oxide is sourced from PubChem (CID 100993183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).