C27H50O3Si2 — CID 100993419
(2S)-2-[(3aR,4S,7aS)-7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-6-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-4-yn-2-ol (PubChem CID 100993419) has the molecular formula C27H50O3Si2 and a molecular weight of 478.87 g/mol. Its IUPAC name is (2S)-2-[(3aR,4S,7aS)-7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-6-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-4-yn-2-ol.
| Compound Name | (2S)-2-[(3aR,4S,7aS)-7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-6-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-4-yn-2-ol |
|---|---|
| PubChem CID | 100993419 |
| Molecular Formula | C27H50O3Si2 |
| Molecular Weight | 478.87 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | (2S)-2-[(3aR,4S,7aS)-7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-6-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-4-yn-2-ol |
| SMILES | CC(C)(C#CC[C@](C)(O)C1=CC[C@H]2[C@@H](O[Si](C)(C)C)CCC[C@]12C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H50O3Si2/c1-24(2,3)32(11,12)30-25(4,5)18-14-20-27(7,28)23-17-16-21-22(29-31(8,9)10)15-13-19-26(21,23)6/h17,21-22,28H,13,15-16,19-20H2,1-12H3/t21-,22-,26-,27-/m0/s1 |
| InChIKey | ARQJMKCEVKPDTC-XQVMISGQSA-N |
| XLogP | 7.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.87 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|