C18H28O5 — CID 100993611
2,3,5,6-tetrakis(methoxymethyl)-3',3'-dimethylspiro[bicyclo[2.2.1]hepta-2,5-diene-7,2'-oxirane] (PubChem CID 100993611) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is 2,3,5,6-tetrakis(methoxymethyl)-3',3'-dimethylspiro[bicyclo[2.2.1]hepta-2,5-diene-7,2'-oxirane].
| Compound Name | 2,3,5,6-tetrakis(methoxymethyl)-3',3'-dimethylspiro[bicyclo[2.2.1]hepta-2,5-diene-7,2'-oxirane] |
|---|---|
| PubChem CID | 100993611 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 2,3,5,6-tetrakis(methoxymethyl)-3',3'-dimethylspiro[bicyclo[2.2.1]hepta-2,5-diene-7,2'-oxirane] |
| SMILES | COCC1=C(COC)C2C(COC)=C(COC)C1C21OC1(C)C |
| InChI | InChI=1S/C18H28O5/c1-17(2)18(23-17)15-11(7-19-3)12(8-20-4)16(18)14(10-22-6)13(15)9-21-5/h15-16H,7-10H2,1-6H3 |
| InChIKey | BRDBFLAIJMZRFF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|