C34H33N3O5 — CID 10099417
N-[3-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-5-methoxy-9-oxo-10H-acridine-4-carboxamide (PubChem CID 10099417) has the molecular formula C34H33N3O5 and a molecular weight of 563.65 g/mol. Its IUPAC name is N-[3-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-5-methoxy-9-oxo-10H-acridine-4-carboxamide.
| Compound Name | N-[3-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-5-methoxy-9-oxo-10H-acridine-4-carboxamide |
|---|---|
| PubChem CID | 10099417 |
| Molecular Formula | C34H33N3O5 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | N-[3-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-5-methoxy-9-oxo-10H-acridine-4-carboxamide |
| SMILES | COc1cc2c(cc1OC)CN(CCc1cccc(NC(=O)c3cccc4c(=O)c5cccc(OC)c5[nH]c34)c1)CC2 |
| InChI | InChI=1S/C34H33N3O5/c1-40-28-12-6-10-26-32(28)36-31-25(33(26)38)9-5-11-27(31)34(39)35-24-8-4-7-21(17-24)13-15-37-16-14-22-18-29(41-2)30(42-3)19-23(22)20-37/h4-12,17-19H,13-16,20H2,1-3H3,(H,35,39)(H,36,38) |
| InChIKey | IXDFGPYSAINEGZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|