C30H34F6N4 — CID 10099430
3,12-bis[[2-(trifluoromethyl)phenyl]methyl]-3,7,12,18-tetrazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene (PubChem CID 10099430) has the molecular formula C30H34F6N4 and a molecular weight of 564.62 g/mol. Its IUPAC name is 3,12-bis[[2-(trifluoromethyl)phenyl]methyl]-3,7,12,18-tetrazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene.
| Compound Name | 3,12-bis[[2-(trifluoromethyl)phenyl]methyl]-3,7,12,18-tetrazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene |
|---|---|
| PubChem CID | 10099430 |
| Molecular Formula | C30H34F6N4 |
| Molecular Weight | 564.62 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | 3,12-bis[[2-(trifluoromethyl)phenyl]methyl]-3,7,12,18-tetrazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene |
| SMILES | FC(F)(F)c1ccccc1CN1CCCCNCCCN(Cc2ccccc2C(F)(F)F)Cc2cccc(n2)C1 |
| InChI | InChI=1S/C30H34F6N4/c31-29(32,33)27-13-3-1-9-23(27)19-39-17-6-5-15-37-16-8-18-40(22-26-12-7-11-25(21-39)38-26)20-24-10-2-4-14-28(24)30(34,35)36/h1-4,7,9-14,37H,5-6,8,15-22H2 |
| InChIKey | OCTHRAZAWCEVJN-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.62 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |