C34H28O4S2 — CID 10099438
4-(4-methylphenyl)sulfanyl-3-[[4-[(3E,5Z)-octa-1,3,5-trien-4-yl]sulfanyl-2-oxochromen-3-yl]methyl]chromen-2-one (PubChem CID 10099438) has the molecular formula C34H28O4S2 and a molecular weight of 564.73 g/mol. Its IUPAC name is 4-(4-methylphenyl)sulfanyl-3-[[4-[(3E,5Z)-octa-1,3,5-trien-4-yl]sulfanyl-2-oxochromen-3-yl]methyl]chromen-2-one.
| Compound Name | 4-(4-methylphenyl)sulfanyl-3-[[4-[(3E,5Z)-octa-1,3,5-trien-4-yl]sulfanyl-2-oxochromen-3-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 10099438 |
| Molecular Formula | C34H28O4S2 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | 4-(4-methylphenyl)sulfanyl-3-[[4-[(3E,5Z)-octa-1,3,5-trien-4-yl]sulfanyl-2-oxochromen-3-yl]methyl]chromen-2-one |
| SMILES | C=C/C=C(\C=C/CC)Sc1c(Cc2c(Sc3ccc(C)cc3)c3ccccc3oc2=O)c(=O)oc2ccccc12 |
| InChI | InChI=1S/C34H28O4S2/c1-4-6-12-23(11-5-2)39-31-25-13-7-9-15-29(25)37-33(35)27(31)21-28-32(40-24-19-17-22(3)18-20-24)26-14-8-10-16-30(26)38-34(28)36/h5-20H,2,4,21H2,1,3H3/b12-6-,23-11+ |
| InChIKey | JCGINLAKKOLLPU-IXMQHKKCSA-N |
| XLogP | 9.08 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|