C17H16Cl2O5 — CID 100994919
(4S,4aS,9aR)-4a,9a-dichloro-4,8-dimethoxy-7-methyl-3,4-dihydro-1H-anthracene-2,9,10-trione (PubChem CID 100994919) has the molecular formula C17H16Cl2O5 and a molecular weight of 371.22 g/mol. Its IUPAC name is (4S,4aS,9aR)-4a,9a-dichloro-4,8-dimethoxy-7-methyl-3,4-dihydro-1H-anthracene-2,9,10-trione.
| Compound Name | (4S,4aS,9aR)-4a,9a-dichloro-4,8-dimethoxy-7-methyl-3,4-dihydro-1H-anthracene-2,9,10-trione |
|---|---|
| PubChem CID | 100994919 |
| Molecular Formula | C17H16Cl2O5 |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | (4S,4aS,9aR)-4a,9a-dichloro-4,8-dimethoxy-7-methyl-3,4-dihydro-1H-anthracene-2,9,10-trione |
| SMILES | COc1c(C)ccc2c1C(=O)[C@]1(Cl)CC(=O)C[C@H](OC)[C@]1(Cl)C2=O |
| InChI | InChI=1S/C17H16Cl2O5/c1-8-4-5-10-12(13(8)24-3)15(22)16(18)7-9(20)6-11(23-2)17(16,19)14(10)21/h4-5,11H,6-7H2,1-3H3/t11-,16+,17-/m0/s1 |
| InChIKey | YHDKMXYQGVNOEG-JECHBYEQSA-N |
| XLogP | 2.72 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|