About (3S,5R)-3,5-bis(methoxymethoxy)oct-1-en-7-yne
(3S,5R)-3,5-bis(methoxymethoxy)oct-1-en-7-yne (PubChem CID 100994944) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is (3S,5R)-3,5-bis(methoxymethoxy)oct-1-en-7-yne.
Molecular Properties
| Compound Name | (3S,5R)-3,5-bis(methoxymethoxy)oct-1-en-7-yne |
| PubChem CID | 100994944 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (3S,5R)-3,5-bis(methoxymethoxy)oct-1-en-7-yne |
| SMILES | C#CC[C@H](C[C@@H](C=C)OCOC)OCOC |
| InChI | InChI=1S/C12H20O4/c1-5-7-12(16-10-14-4)8-11(6-2)15-9-13-3/h1,6,11-12H,2,7-10H2,3-4H3/t11-,12-/m1/s1 |
| InChIKey | XPZPYCFBDPUWAJ-VXGBXAGGSA-N |
| XLogP | 1.56 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S,5R)-3,5-bis(methoxymethoxy)oct-1-en-7-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5R)-3,5-bis(methoxymethoxy)oct-1-en-7-yne?
The IUPAC name of (3S,5R)-3,5-bis(methoxymethoxy)oct-1-en-7-yne (CID 100994944) is (3S,5R)-3,5-bis(methoxymethoxy)oct-1-en-7-yne.
What is the SMILES notation for (3S,5R)-3,5-bis(methoxymethoxy)oct-1-en-7-yne?
The canonical SMILES for (3S,5R)-3,5-bis(methoxymethoxy)oct-1-en-7-yne is C#CC[C@H](C[C@@H](C=C)OCOC)OCOC.
What is the InChIKey of (3S,5R)-3,5-bis(methoxymethoxy)oct-1-en-7-yne?
The InChIKey is XPZPYCFBDPUWAJ-VXGBXAGGSA-N. The full InChI is InChI=1S/C12H20O4/c1-5-7-12(16-10-14-4)8-11(6-2)15-9-13-3/h1,6,11-12H,2,7-10H2,3-4H3/t11-,12-/m1/s1.
What are the key properties of (3S,5R)-3,5-bis(methoxymethoxy)oct-1-en-7-yne?
(3S,5R)-3,5-bis(methoxymethoxy)oct-1-en-7-yne has a molecular weight of 228.29 g/mol, XLogP of 1.56, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5R)-3,5-bis(methoxymethoxy)oct-1-en-7-yne is sourced from PubChem (CID 100994944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).