C14H16F3NO6 — CID 100995327
(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[3-methyl-4-(trifluoromethyl)anilino]oxane-2-carboxylic acid (PubChem CID 100995327) has the molecular formula C14H16F3NO6 and a molecular weight of 351.28 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[3-methyl-4-(trifluoromethyl)anilino]oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[3-methyl-4-(trifluoromethyl)anilino]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 100995327 |
| Molecular Formula | C14H16F3NO6 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[3-methyl-4-(trifluoromethyl)anilino]oxane-2-carboxylic acid |
| SMILES | Cc1cc(N[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)ccc1C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO6/c1-5-4-6(2-3-7(5)14(15,16)17)18-12-10(21)8(19)9(20)11(24-12)13(22)23/h2-4,8-12,18-21H,1H3,(H,22,23)/t8-,9-,10+,11-,12+/m0/s1 |
| InChIKey | DAAFGIAYXFMMBZ-HHHUOAJASA-N |
| XLogP | 0.32 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |