C16H22Br2O7 — CID 100995508
dimethyl (1S,2S,3R,4R)-5,6-dibromo-1-(3-hydroxypropyl)-7,7-dimethoxybicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 100995508) has the molecular formula C16H22Br2O7 and a molecular weight of 486.15 g/mol. Its IUPAC name is dimethyl (1S,2S,3R,4R)-5,6-dibromo-1-(3-hydroxypropyl)-7,7-dimethoxybicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | dimethyl (1S,2S,3R,4R)-5,6-dibromo-1-(3-hydroxypropyl)-7,7-dimethoxybicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 100995508 |
| Molecular Formula | C16H22Br2O7 |
| Molecular Weight | 486.15 g/mol |
| Exact Mass | 483.97 |
| IUPAC Name | dimethyl (1S,2S,3R,4R)-5,6-dibromo-1-(3-hydroxypropyl)-7,7-dimethoxybicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2C(Br)=C(Br)[C@@](CCCO)([C@H]1C(=O)OC)C2(OC)OC |
| InChI | InChI=1S/C16H22Br2O7/c1-22-13(20)8-9-11(17)12(18)15(6-5-7-19,10(8)14(21)23-2)16(9,24-3)25-4/h8-10,19H,5-7H2,1-4H3/t8-,9-,10+,15+/m0/s1 |
| InChIKey | PJYIXUHXEHRQIC-SPTRTOBYSA-N |
| XLogP | 1.96 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.15 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|