C18H30O17 — CID 100995680
(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexoxy]oxan-2-yl]methoxy]oxane-2-carboxylic acid (PubChem CID 100995680) has the molecular formula C18H30O17 and a molecular weight of 518.42 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexoxy]oxan-2-yl]methoxy]oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexoxy]oxan-2-yl]methoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 100995680 |
| Molecular Formula | C18H30O17 |
| Molecular Weight | 518.42 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexoxy]oxan-2-yl]methoxy]oxane-2-carboxylic acid |
| SMILES | O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO[C@@H]1O[C@H](CO[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H30O17/c19-1-4(20)7(22)8(23)5(21)2-32-17-13(28)10(25)9(24)6(34-17)3-33-18-14(29)11(26)12(27)15(35-18)16(30)31/h1,4-15,17-18,20-29H,2-3H2,(H,30,31)/t4-,5+,6+,7+,8-,9-,10-,11-,12-,13+,14+,15-,17+,18+/m0/s1 |
| InChIKey | MZGHCTUHDBCEGG-AXMTYGJCSA-N |
| XLogP | -7.64 |
| TPSA | 293.59 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.42 |
| LogP ≤ 5 | -7.64 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|