C23H18Br2F3NO3 — CID 10099595
[(1R,2R)-2,4-dibromo-1,2,3,4-tetrahydroacridin-1-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10099595) has the molecular formula C23H18Br2F3NO3 and a molecular weight of 573.20 g/mol. Its IUPAC name is [(1R,2R)-2,4-dibromo-1,2,3,4-tetrahydroacridin-1-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1R,2R)-2,4-dibromo-1,2,3,4-tetrahydroacridin-1-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10099595 |
| Molecular Formula | C23H18Br2F3NO3 |
| Molecular Weight | 573.20 g/mol |
| Exact Mass | 570.96 |
| IUPAC Name | [(1R,2R)-2,4-dibromo-1,2,3,4-tetrahydroacridin-1-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@](C(=O)O[C@@H]1c2cc3ccccc3nc2C(Br)C[C@H]1Br)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C23H18Br2F3NO3/c1-31-22(23(26,27)28,14-8-3-2-4-9-14)21(30)32-20-15-11-13-7-5-6-10-18(13)29-19(15)16(24)12-17(20)25/h2-11,16-17,20H,12H2,1H3/t16?,17-,20-,22+/m1/s1 |
| InChIKey | DBRBSZNLEXDEDL-LHLNQDCLSA-N |
| XLogP | 6.53 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.20 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|