C27H20Cl2N+ — CID 10099610
(1R,8R)-16,16-bis(4-chlorophenyl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene (PubChem CID 10099610) has the molecular formula C27H20Cl2N+ and a molecular weight of 429.37 g/mol. Its IUPAC name is (1R,8R)-16,16-bis(4-chlorophenyl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene.
| Compound Name | (1R,8R)-16,16-bis(4-chlorophenyl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene |
|---|---|
| PubChem CID | 10099610 |
| Molecular Formula | C27H20Cl2N+ |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | (1R,8R)-16,16-bis(4-chlorophenyl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene |
| SMILES | Clc1ccc(C2(c3ccc(Cl)cc3)C[C@@H]3c4ccccc4[C@H]2c2cccc[n+]23)cc1 |
| InChI | InChI=1S/C27H20Cl2N/c28-20-12-8-18(9-13-20)27(19-10-14-21(29)15-11-19)17-25-22-5-1-2-6-23(22)26(27)24-7-3-4-16-30(24)25/h1-16,25-26H,17H2/q+1/t25-,26+/m1/s1 |
| InChIKey | ODRBAJLZAAFLGG-FTJBHMTQSA-N |
| XLogP | 6.71 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|