C29H29FN4O7 — CID 100996111
9-[2-(2-fluorophenyl)ethyl]-N-(2-methoxyethyl)-4-nitro-8,11-dioxo-2-oxa-9,12-diazatricyclo[13.3.1.13,7]icosa-1(18),3,5,7(20),15(19),16-hexaene-13-carboxamide (PubChem CID 100996111) has the molecular formula C29H29FN4O7 and a molecular weight of 564.57 g/mol. Its IUPAC name is 9-[2-(2-fluorophenyl)ethyl]-N-(2-methoxyethyl)-4-nitro-8,11-dioxo-2-oxa-9,12-diazatricyclo[13.3.1.13,7]icosa-1(18),3,5,7(20),15(19),16-hexaene-13-carboxamide.
| Compound Name | 9-[2-(2-fluorophenyl)ethyl]-N-(2-methoxyethyl)-4-nitro-8,11-dioxo-2-oxa-9,12-diazatricyclo[13.3.1.13,7]icosa-1(18),3,5,7(20),15(19),16-hexaene-13-carboxamide |
|---|---|
| PubChem CID | 100996111 |
| Molecular Formula | C29H29FN4O7 |
| Molecular Weight | 564.57 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | 9-[2-(2-fluorophenyl)ethyl]-N-(2-methoxyethyl)-4-nitro-8,11-dioxo-2-oxa-9,12-diazatricyclo[13.3.1.13,7]icosa-1(18),3,5,7(20),15(19),16-hexaene-13-carboxamide |
| SMILES | COCCNC(=O)C1Cc2cccc(c2)Oc2cc(ccc2[N+](=O)[O-])C(=O)N(CCc2ccccc2F)CC(=O)N1 |
| InChI | InChI=1S/C29H29FN4O7/c1-40-14-12-31-28(36)24-16-19-5-4-7-22(15-19)41-26-17-21(9-10-25(26)34(38)39)29(37)33(18-27(35)32-24)13-11-20-6-2-3-8-23(20)30/h2-10,15,17,24H,11-14,16,18H2,1H3,(H,31,36)(H,32,35) |
| InChIKey | OOSWNBJSGMWZQG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.57 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|