C23H38N2O5Si — CID 100996224
(2S,3S,4S,5R)-N-benzyl-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-3-triethylsilyloxypyrrolidine-2-carboxamide (PubChem CID 100996224) has the molecular formula C23H38N2O5Si and a molecular weight of 450.65 g/mol. Its IUPAC name is (2S,3S,4S,5R)-N-benzyl-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-3-triethylsilyloxypyrrolidine-2-carboxamide.
| Compound Name | (2S,3S,4S,5R)-N-benzyl-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-3-triethylsilyloxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 100996224 |
| Molecular Formula | C23H38N2O5Si |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | (2S,3S,4S,5R)-N-benzyl-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-3-triethylsilyloxypyrrolidine-2-carboxamide |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H](O)[C@H]([C@H]2COC(C)(C)O2)N[C@@H]1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H38N2O5Si/c1-6-31(7-2,8-3)30-21-19(22(27)24-14-16-12-10-9-11-13-16)25-18(20(21)26)17-15-28-23(4,5)29-17/h9-13,17-21,25-26H,6-8,14-15H2,1-5H3,(H,24,27)/t17-,18+,19+,20+,21+/m1/s1 |
| InChIKey | WPFQXFAITUWATH-SYAJIYQZSA-N |
| XLogP | 2.55 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|