C29H31F2N — CID 100996687
(1R,2R,3R,5S)-2,3-bis(4-fluorophenyl)-8-(4-phenylbutyl)-8-azabicyclo[3.2.1]octane (PubChem CID 100996687) has the molecular formula C29H31F2N and a molecular weight of 431.57 g/mol. Its IUPAC name is (1R,2R,3R,5S)-2,3-bis(4-fluorophenyl)-8-(4-phenylbutyl)-8-azabicyclo[3.2.1]octane.
| Compound Name | (1R,2R,3R,5S)-2,3-bis(4-fluorophenyl)-8-(4-phenylbutyl)-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 100996687 |
| Molecular Formula | C29H31F2N |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | (1R,2R,3R,5S)-2,3-bis(4-fluorophenyl)-8-(4-phenylbutyl)-8-azabicyclo[3.2.1]octane |
| SMILES | Fc1ccc([C@@H]2[C@H]3CC[C@@H](C[C@H]2c2ccc(F)cc2)N3CCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H31F2N/c30-24-13-9-22(10-14-24)27-20-26-17-18-28(29(27)23-11-15-25(31)16-12-23)32(26)19-5-4-8-21-6-2-1-3-7-21/h1-3,6-7,9-16,26-29H,4-5,8,17-20H2/t26-,27-,28+,29-/m0/s1 |
| InChIKey | HHGRRWHYCCTJGT-FKWFRFQNSA-N |
| XLogP | 7.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|