About CID 100996748
CID 100996748 (PubChem CID 100996748) has the molecular formula C22H21Br2F6
and a molecular weight of 559.21 g/mol.
Molecular Properties
| Compound Name | CID 100996748 |
| PubChem CID | 100996748 |
| Molecular Formula | C22H21Br2F6 |
| Molecular Weight | 559.21 g/mol |
| Exact Mass | 556.99 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(C(F)(F)F)c([CH]c2c(Br)cc(C(C)(C)C)cc2Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H21Br2F6/c1-11(2)12-6-16(21(25,26)27)14(17(7-12)22(28,29)30)10-15-18(23)8-13(9-19(15)24)20(3,4)5/h6-11H,1-5H3 |
| InChIKey | XRXUEJRHHCKEAG-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 559.21 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 100996748 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 100996748?
The IUPAC name of CID 100996748 (CID 100996748) is not available.
What is the SMILES notation for CID 100996748?
The canonical SMILES for CID 100996748 is CC(C)c1cc(C(F)(F)F)c([CH]c2c(Br)cc(C(C)(C)C)cc2Br)c(C(F)(F)F)c1.
What is the InChIKey of CID 100996748?
The InChIKey is XRXUEJRHHCKEAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21Br2F6/c1-11(2)12-6-16(21(25,26)27)14(17(7-12)22(28,29)30)10-15-18(23)8-13(9-19(15)24)20(3,4)5/h6-11H,1-5H3.
What are the key properties of CID 100996748?
CID 100996748 has a molecular weight of 559.21 g/mol, XLogP of 9.27, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 100996748 is sourced from PubChem (CID 100996748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).