C28H24Cl4N2O3 — CID 10099693
4-chloro-N-[5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-2-(2,2-dimethylpropanoyl)furo[2,3-b]pyridin-3-yl]butanamide (PubChem CID 10099693) has the molecular formula C28H24Cl4N2O3 and a molecular weight of 578.32 g/mol. Its IUPAC name is 4-chloro-N-[5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-2-(2,2-dimethylpropanoyl)furo[2,3-b]pyridin-3-yl]butanamide.
| Compound Name | 4-chloro-N-[5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-2-(2,2-dimethylpropanoyl)furo[2,3-b]pyridin-3-yl]butanamide |
|---|---|
| PubChem CID | 10099693 |
| Molecular Formula | C28H24Cl4N2O3 |
| Molecular Weight | 578.32 g/mol |
| Exact Mass | 576.05 |
| IUPAC Name | 4-chloro-N-[5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-2-(2,2-dimethylpropanoyl)furo[2,3-b]pyridin-3-yl]butanamide |
| SMILES | CC(C)(C)C(=O)c1oc2nc(-c3ccc(Cl)cc3Cl)c(-c3ccc(Cl)cc3)cc2c1NC(=O)CCCCl |
| InChI | InChI=1S/C28H24Cl4N2O3/c1-28(2,3)26(36)25-24(33-22(35)5-4-12-29)20-14-19(15-6-8-16(30)9-7-15)23(34-27(20)37-25)18-11-10-17(31)13-21(18)32/h6-11,13-14H,4-5,12H2,1-3H3,(H,33,35) |
| InChIKey | VDKABYCIRNCYPW-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.32 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|