About 4-N-cyclohexyl-2-N-pentylpyrimidine-2,4,6-triamine
4-N-cyclohexyl-2-N-pentylpyrimidine-2,4,6-triamine (PubChem CID 100996947) has the molecular formula C15H27N5
and a molecular weight of 277.42 g/mol. Its IUPAC name is 4-N-cyclohexyl-2-N-pentylpyrimidine-2,4,6-triamine.
Molecular Properties
| Compound Name | 4-N-cyclohexyl-2-N-pentylpyrimidine-2,4,6-triamine |
| PubChem CID | 100996947 |
| Molecular Formula | C15H27N5 |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.23 |
| IUPAC Name | 4-N-cyclohexyl-2-N-pentylpyrimidine-2,4,6-triamine |
| SMILES | CCCCCNc1nc(N)cc(NC2CCCCC2)n1 |
| InChI | InChI=1S/C15H27N5/c1-2-3-7-10-17-15-19-13(16)11-14(20-15)18-12-8-5-4-6-9-12/h11-12H,2-10H2,1H3,(H4,16,17,18,19,20) |
| InChIKey | IVBHZKAWWMJYPF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-N-cyclohexyl-2-N-pentylpyrimidine-2,4,6-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-cyclohexyl-2-N-pentylpyrimidine-2,4,6-triamine?
The IUPAC name of 4-N-cyclohexyl-2-N-pentylpyrimidine-2,4,6-triamine (CID 100996947) is 4-N-cyclohexyl-2-N-pentylpyrimidine-2,4,6-triamine.
What is the SMILES notation for 4-N-cyclohexyl-2-N-pentylpyrimidine-2,4,6-triamine?
The canonical SMILES for 4-N-cyclohexyl-2-N-pentylpyrimidine-2,4,6-triamine is CCCCCNc1nc(N)cc(NC2CCCCC2)n1.
What is the InChIKey of 4-N-cyclohexyl-2-N-pentylpyrimidine-2,4,6-triamine?
The InChIKey is IVBHZKAWWMJYPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N5/c1-2-3-7-10-17-15-19-13(16)11-14(20-15)18-12-8-5-4-6-9-12/h11-12H,2-10H2,1H3,(H4,16,17,18,19,20).
What are the key properties of 4-N-cyclohexyl-2-N-pentylpyrimidine-2,4,6-triamine?
4-N-cyclohexyl-2-N-pentylpyrimidine-2,4,6-triamine has a molecular weight of 277.42 g/mol, XLogP of 3.41, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-cyclohexyl-2-N-pentylpyrimidine-2,4,6-triamine is sourced from PubChem (CID 100996947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).