C37H36F6O6 — CID 100996970
(2R,3R,4S,5R,6R)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 100996970) has the molecular formula C37H36F6O6 and a molecular weight of 690.68 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,3R,4S,5R,6R)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 100996970 |
| Molecular Formula | C37H36F6O6 |
| Molecular Weight | 690.68 g/mol |
| Exact Mass | 690.24 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | FC(F)(F)C(O[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C37H36F6O6/c38-36(39,40)35(37(41,42)43)49-34-33(47-24-29-19-11-4-12-20-29)32(46-23-28-17-9-3-10-18-28)31(45-22-27-15-7-2-8-16-27)30(48-34)25-44-21-26-13-5-1-6-14-26/h1-20,30-35H,21-25H2/t30-,31-,32+,33-,34-/m1/s1 |
| InChIKey | GDKJCXPVBZYRCI-BGSSSCFASA-N |
| XLogP | 8.19 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.68 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |