About ethyl (3R)-3-[(4S,5R)-5-ethenyl-1,3-dioxolan-4-yl]-4-nitrobutanoate
ethyl (3R)-3-[(4S,5R)-5-ethenyl-1,3-dioxolan-4-yl]-4-nitrobutanoate (PubChem CID 100997213) has the molecular formula C11H17NO6
and a molecular weight of 259.26 g/mol. Its IUPAC name is ethyl (3R)-3-[(4S,5R)-5-ethenyl-1,3-dioxolan-4-yl]-4-nitrobutanoate.
Molecular Properties
| Compound Name | ethyl (3R)-3-[(4S,5R)-5-ethenyl-1,3-dioxolan-4-yl]-4-nitrobutanoate |
| PubChem CID | 100997213 |
| Molecular Formula | C11H17NO6 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | ethyl (3R)-3-[(4S,5R)-5-ethenyl-1,3-dioxolan-4-yl]-4-nitrobutanoate |
| SMILES | C=C[C@H]1OCO[C@H]1[C@H](CC(=O)OCC)C[N+](=O)[O-] |
| InChI | InChI=1S/C11H17NO6/c1-3-9-11(18-7-17-9)8(6-12(14)15)5-10(13)16-4-2/h3,8-9,11H,1,4-7H2,2H3/t8-,9-,11+/m1/s1 |
| InChIKey | LZCZVMCVNJTKHU-KKZNHRDASA-N |
| XLogP | 0.76 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (3R)-3-[(4S,5R)-5-ethenyl-1,3-dioxolan-4-yl]-4-nitrobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3R)-3-[(4S,5R)-5-ethenyl-1,3-dioxolan-4-yl]-4-nitrobutanoate?
The IUPAC name of ethyl (3R)-3-[(4S,5R)-5-ethenyl-1,3-dioxolan-4-yl]-4-nitrobutanoate (CID 100997213) is ethyl (3R)-3-[(4S,5R)-5-ethenyl-1,3-dioxolan-4-yl]-4-nitrobutanoate.
What is the SMILES notation for ethyl (3R)-3-[(4S,5R)-5-ethenyl-1,3-dioxolan-4-yl]-4-nitrobutanoate?
The canonical SMILES for ethyl (3R)-3-[(4S,5R)-5-ethenyl-1,3-dioxolan-4-yl]-4-nitrobutanoate is C=C[C@H]1OCO[C@H]1[C@H](CC(=O)OCC)C[N+](=O)[O-].
What is the InChIKey of ethyl (3R)-3-[(4S,5R)-5-ethenyl-1,3-dioxolan-4-yl]-4-nitrobutanoate?
The InChIKey is LZCZVMCVNJTKHU-KKZNHRDASA-N. The full InChI is InChI=1S/C11H17NO6/c1-3-9-11(18-7-17-9)8(6-12(14)15)5-10(13)16-4-2/h3,8-9,11H,1,4-7H2,2H3/t8-,9-,11+/m1/s1.
What are the key properties of ethyl (3R)-3-[(4S,5R)-5-ethenyl-1,3-dioxolan-4-yl]-4-nitrobutanoate?
ethyl (3R)-3-[(4S,5R)-5-ethenyl-1,3-dioxolan-4-yl]-4-nitrobutanoate has a molecular weight of 259.26 g/mol, XLogP of 0.76, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3R)-3-[(4S,5R)-5-ethenyl-1,3-dioxolan-4-yl]-4-nitrobutanoate is sourced from PubChem (CID 100997213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).