C10H20O4Si — CID 100997229
triethoxy(1-methoxypropa-1,2-dienyl)silane (PubChem CID 100997229) has the molecular formula C10H20O4Si and a molecular weight of 232.35 g/mol. Its IUPAC name is triethoxy(1-methoxypropa-1,2-dienyl)silane.
| Compound Name | triethoxy(1-methoxypropa-1,2-dienyl)silane |
|---|---|
| PubChem CID | 100997229 |
| Molecular Formula | C10H20O4Si |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | triethoxy(1-methoxypropa-1,2-dienyl)silane |
| SMILES | C=C=C(OC)[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C10H20O4Si/c1-6-10(11-5)15(12-7-2,13-8-3)14-9-4/h1,7-9H2,2-5H3 |
| InChIKey | YIGYTVPFIDXSNE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|