C34H39N3O3 — CID 100997619
(10S,13S)-10-benzyl-13-(hydroxymethyl)-9-pentyl-5-(3-phenylpropanoyl)-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1,4,6,8(15)-tetraen-11-one (PubChem CID 100997619) has the molecular formula C34H39N3O3 and a molecular weight of 537.70 g/mol. Its IUPAC name is (10S,13S)-10-benzyl-13-(hydroxymethyl)-9-pentyl-5-(3-phenylpropanoyl)-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1,4,6,8(15)-tetraen-11-one.
| Compound Name | (10S,13S)-10-benzyl-13-(hydroxymethyl)-9-pentyl-5-(3-phenylpropanoyl)-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1,4,6,8(15)-tetraen-11-one |
|---|---|
| PubChem CID | 100997619 |
| Molecular Formula | C34H39N3O3 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | (10S,13S)-10-benzyl-13-(hydroxymethyl)-9-pentyl-5-(3-phenylpropanoyl)-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1,4,6,8(15)-tetraen-11-one |
| SMILES | CCCCCN1c2ccc(C(=O)CCc3ccccc3)c3[nH]cc(c23)C[C@@H](CO)NC(=O)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C34H39N3O3/c1-2-3-10-19-37-29-17-16-28(31(39)18-15-24-11-6-4-7-12-24)33-32(29)26(22-35-33)21-27(23-38)36-34(40)30(37)20-25-13-8-5-9-14-25/h4-9,11-14,16-17,22,27,30,35,38H,2-3,10,15,18-21,23H2,1H3,(H,36,40)/t27-,30-/m0/s1 |
| InChIKey | FFNCDJFXGOOQDV-FIBWVYCGSA-N |
| XLogP | 5.62 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|