C14H22O2 — CID 100997719
5-[(3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]hex-5-en-2-one (PubChem CID 100997719) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 5-[(3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]hex-5-en-2-one.
| Compound Name | 5-[(3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]hex-5-en-2-one |
|---|---|
| PubChem CID | 100997719 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 5-[(3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]hex-5-en-2-one |
| SMILES | C=C(CCC(C)=O)C1C[C@H]2CCCC[C@H]2O1 |
| InChI | InChI=1S/C14H22O2/c1-10(7-8-11(2)15)14-9-12-5-3-4-6-13(12)16-14/h12-14H,1,3-9H2,2H3/t12-,13-,14?/m1/s1 |
| InChIKey | AFHJEIPLOFPKBC-ZFXTZCCVSA-N |
| XLogP | 3.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|