C33H32O10 — CID 100998241
(13R,23S)-3,13,19,23-tetrahydroxy-5,7,29-trimethoxy-13,23-dimethyl-16-oxahexacyclo[15.12.0.02,11.04,9.018,27.020,25]nonacosa-1(17),2,4,6,8,10,18,20(25),26,28-decaene-15,21-dione (PubChem CID 100998241) has the molecular formula C33H32O10 and a molecular weight of 588.61 g/mol. Its IUPAC name is (13R,23S)-3,13,19,23-tetrahydroxy-5,7,29-trimethoxy-13,23-dimethyl-16-oxahexacyclo[15.12.0.02,11.04,9.018,27.020,25]nonacosa-1(17),2,4,6,8,10,18,20(25),26,28-decaene-15,21-dione.
| Compound Name | (13R,23S)-3,13,19,23-tetrahydroxy-5,7,29-trimethoxy-13,23-dimethyl-16-oxahexacyclo[15.12.0.02,11.04,9.018,27.020,25]nonacosa-1(17),2,4,6,8,10,18,20(25),26,28-decaene-15,21-dione |
|---|---|
| PubChem CID | 100998241 |
| Molecular Formula | C33H32O10 |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | (13R,23S)-3,13,19,23-tetrahydroxy-5,7,29-trimethoxy-13,23-dimethyl-16-oxahexacyclo[15.12.0.02,11.04,9.018,27.020,25]nonacosa-1(17),2,4,6,8,10,18,20(25),26,28-decaene-15,21-dione |
| SMILES | COc1cc(OC)c2c(O)c3c(cc2c1)C[C@@](C)(O)CC(=O)Oc1c-3c(OC)cc2cc3c(c(O)c12)C(=O)C[C@@](C)(O)C3 |
| InChI | InChI=1S/C33H32O10/c1-32(38)11-17-7-16-9-21(41-4)28-26-18(6-15-8-19(40-3)10-22(42-5)25(15)30(26)37)12-33(2,39)14-23(35)43-31(28)27(16)29(36)24(17)20(34)13-32/h6-10,36-39H,11-14H2,1-5H3/t32-,33+/m0/s1 |
| InChIKey | MJEUMYPNZRZMBF-JHOUSYSJSA-N |
| XLogP | 4.58 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|