C18H16F3NO2 — CID 100998255
(4R,5S)-3,4-dibenzyl-5-(trifluoromethyl)-1,3-oxazolidin-2-one (PubChem CID 100998255) has the molecular formula C18H16F3NO2 and a molecular weight of 335.32 g/mol. Its IUPAC name is (4R,5S)-3,4-dibenzyl-5-(trifluoromethyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3,4-dibenzyl-5-(trifluoromethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 100998255 |
| Molecular Formula | C18H16F3NO2 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | (4R,5S)-3,4-dibenzyl-5-(trifluoromethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@H](C(F)(F)F)[C@@H](Cc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H16F3NO2/c19-18(20,21)16-15(11-13-7-3-1-4-8-13)22(17(23)24-16)12-14-9-5-2-6-10-14/h1-10,15-16H,11-12H2/t15-,16+/m1/s1 |
| InChIKey | ZKVHQOVTJHFNIQ-CVEARBPZSA-N |
| XLogP | 4.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |