C20H28O2 — CID 100998297
2-[(2E,6Z)-3-methyltetradeca-2,6-dien-4,8-diynoxy]oxane (PubChem CID 100998297) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is 2-[(2E,6Z)-3-methyltetradeca-2,6-dien-4,8-diynoxy]oxane.
| Compound Name | 2-[(2E,6Z)-3-methyltetradeca-2,6-dien-4,8-diynoxy]oxane |
|---|---|
| PubChem CID | 100998297 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 2-[(2E,6Z)-3-methyltetradeca-2,6-dien-4,8-diynoxy]oxane |
| SMILES | CCCCCC#C/C=C\C#C/C(C)=C/COC1CCCCO1 |
| InChI | InChI=1S/C20H28O2/c1-3-4-5-6-7-8-9-10-11-14-19(2)16-18-22-20-15-12-13-17-21-20/h9-10,16,20H,3-6,12-13,15,17-18H2,1-2H3/b10-9-,19-16+ |
| InChIKey | DDTDWZKZAOTHAA-AHSMHQSJSA-N |
| XLogP | 4.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|