About 2-[(E)-4-iodo-3-methylbut-3-enyl]-1,3,3-trimethylcyclohexene
2-[(E)-4-iodo-3-methylbut-3-enyl]-1,3,3-trimethylcyclohexene (PubChem CID 100998652) has the molecular formula C14H23I
and a molecular weight of 318.24 g/mol. Its IUPAC name is 2-[(E)-4-iodo-3-methylbut-3-enyl]-1,3,3-trimethylcyclohexene.
Molecular Properties
| Compound Name | 2-[(E)-4-iodo-3-methylbut-3-enyl]-1,3,3-trimethylcyclohexene |
| PubChem CID | 100998652 |
| Molecular Formula | C14H23I |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-[(E)-4-iodo-3-methylbut-3-enyl]-1,3,3-trimethylcyclohexene |
| SMILES | CC1=C(CC/C(C)=C/I)C(C)(C)CCC1 |
| InChI | InChI=1S/C14H23I/c1-11(10-15)7-8-13-12(2)6-5-9-14(13,3)4/h10H,5-9H2,1-4H3/b11-10+ |
| InChIKey | RTFCFCVRNQJQQK-ZHACJKMWSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-4-iodo-3-methylbut-3-enyl]-1,3,3-trimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-4-iodo-3-methylbut-3-enyl]-1,3,3-trimethylcyclohexene?
The IUPAC name of 2-[(E)-4-iodo-3-methylbut-3-enyl]-1,3,3-trimethylcyclohexene (CID 100998652) is 2-[(E)-4-iodo-3-methylbut-3-enyl]-1,3,3-trimethylcyclohexene.
What is the SMILES notation for 2-[(E)-4-iodo-3-methylbut-3-enyl]-1,3,3-trimethylcyclohexene?
The canonical SMILES for 2-[(E)-4-iodo-3-methylbut-3-enyl]-1,3,3-trimethylcyclohexene is CC1=C(CC/C(C)=C/I)C(C)(C)CCC1.
What is the InChIKey of 2-[(E)-4-iodo-3-methylbut-3-enyl]-1,3,3-trimethylcyclohexene?
The InChIKey is RTFCFCVRNQJQQK-ZHACJKMWSA-N. The full InChI is InChI=1S/C14H23I/c1-11(10-15)7-8-13-12(2)6-5-9-14(13,3)4/h10H,5-9H2,1-4H3/b11-10+.
What are the key properties of 2-[(E)-4-iodo-3-methylbut-3-enyl]-1,3,3-trimethylcyclohexene?
2-[(E)-4-iodo-3-methylbut-3-enyl]-1,3,3-trimethylcyclohexene has a molecular weight of 318.24 g/mol, XLogP of 5.63, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-4-iodo-3-methylbut-3-enyl]-1,3,3-trimethylcyclohexene is sourced from PubChem (CID 100998652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).