About 2-(3-chloropropyl)-2-ethyl-1,3-oxathiolane
2-(3-chloropropyl)-2-ethyl-1,3-oxathiolane (PubChem CID 100998761) has the molecular formula C8H15ClOS
and a molecular weight of 194.73 g/mol. Its IUPAC name is 2-(3-chloropropyl)-2-ethyl-1,3-oxathiolane.
Molecular Properties
| Compound Name | 2-(3-chloropropyl)-2-ethyl-1,3-oxathiolane |
| PubChem CID | 100998761 |
| Molecular Formula | C8H15ClOS |
| Molecular Weight | 194.73 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 2-(3-chloropropyl)-2-ethyl-1,3-oxathiolane |
| SMILES | CCC1(CCCCl)OCCS1 |
| InChI | InChI=1S/C8H15ClOS/c1-2-8(4-3-5-9)10-6-7-11-8/h2-7H2,1H3 |
| InChIKey | BMTSNBRODFOCII-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.73 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-chloropropyl)-2-ethyl-1,3-oxathiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chloropropyl)-2-ethyl-1,3-oxathiolane?
The IUPAC name of 2-(3-chloropropyl)-2-ethyl-1,3-oxathiolane (CID 100998761) is 2-(3-chloropropyl)-2-ethyl-1,3-oxathiolane.
What is the SMILES notation for 2-(3-chloropropyl)-2-ethyl-1,3-oxathiolane?
The canonical SMILES for 2-(3-chloropropyl)-2-ethyl-1,3-oxathiolane is CCC1(CCCCl)OCCS1.
What is the InChIKey of 2-(3-chloropropyl)-2-ethyl-1,3-oxathiolane?
The InChIKey is BMTSNBRODFOCII-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15ClOS/c1-2-8(4-3-5-9)10-6-7-11-8/h2-7H2,1H3.
What are the key properties of 2-(3-chloropropyl)-2-ethyl-1,3-oxathiolane?
2-(3-chloropropyl)-2-ethyl-1,3-oxathiolane has a molecular weight of 194.73 g/mol, XLogP of 2.88, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloropropyl)-2-ethyl-1,3-oxathiolane is sourced from PubChem (CID 100998761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).