C9H18O4 — CID 100998822
(3S,4R,5R,6R)-6-methyl-5-propan-2-yloxyoxane-3,4-diol (PubChem CID 100998822) has the molecular formula C9H18O4 and a molecular weight of 190.24 g/mol. Its IUPAC name is (3S,4R,5R,6R)-6-methyl-5-propan-2-yloxyoxane-3,4-diol.
| Compound Name | (3S,4R,5R,6R)-6-methyl-5-propan-2-yloxyoxane-3,4-diol |
|---|---|
| PubChem CID | 100998822 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | (3S,4R,5R,6R)-6-methyl-5-propan-2-yloxyoxane-3,4-diol |
| SMILES | CC(C)O[C@@H]1[C@H](O)[C@@H](O)CO[C@@H]1C |
| InChI | InChI=1S/C9H18O4/c1-5(2)13-9-6(3)12-4-7(10)8(9)11/h5-11H,4H2,1-3H3/t6-,7+,8-,9+/m1/s1 |
| InChIKey | DZHGATFGJQFGBR-XAVMHZPKSA-N |
| XLogP | -0.08 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |