C22H26O7 — CID 100999011
(3R,4aS,5R,6R)-5-ethenyl-6-hydroxy-3-[(4S)-4-hydroxy-6-(4-hydroxyphenyl)-2-oxohexyl]-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-1-one (PubChem CID 100999011) has the molecular formula C22H26O7 and a molecular weight of 402.44 g/mol. Its IUPAC name is (3R,4aS,5R,6R)-5-ethenyl-6-hydroxy-3-[(4S)-4-hydroxy-6-(4-hydroxyphenyl)-2-oxohexyl]-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-1-one.
| Compound Name | (3R,4aS,5R,6R)-5-ethenyl-6-hydroxy-3-[(4S)-4-hydroxy-6-(4-hydroxyphenyl)-2-oxohexyl]-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-1-one |
|---|---|
| PubChem CID | 100999011 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (3R,4aS,5R,6R)-5-ethenyl-6-hydroxy-3-[(4S)-4-hydroxy-6-(4-hydroxyphenyl)-2-oxohexyl]-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-1-one |
| SMILES | C=C[C@H]1[C@H](O)OC=C2C(=O)O[C@@H](CC(=O)C[C@@H](O)CCc3ccc(O)cc3)C[C@H]21 |
| InChI | InChI=1S/C22H26O7/c1-2-18-19-11-17(29-22(27)20(19)12-28-21(18)26)10-16(25)9-15(24)8-5-13-3-6-14(23)7-4-13/h2-4,6-7,12,15,17-19,21,23-24,26H,1,5,8-11H2/t15-,17-,18+,19-,21+/m0/s1 |
| InChIKey | MDFAEFBHZHLOHV-YLCUBWEDSA-N |
| XLogP | 2.00 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|