C33H32O10 — CID 10099902
[6,7-dihydroxy-8-(hydroxymethyl)-4,17-dimethyl-5-oxo-13-phenyl-15-prop-1-en-2-yl-9,12,14,18-tetraoxahexacyclo[11.4.1.01,10.02,6.08,10.011,15]octadec-3-en-16-yl] benzoate (PubChem CID 10099902) has the molecular formula C33H32O10 and a molecular weight of 588.61 g/mol. Its IUPAC name is [6,7-dihydroxy-8-(hydroxymethyl)-4,17-dimethyl-5-oxo-13-phenyl-15-prop-1-en-2-yl-9,12,14,18-tetraoxahexacyclo[11.4.1.01,10.02,6.08,10.011,15]octadec-3-en-16-yl] benzoate.
| Compound Name | [6,7-dihydroxy-8-(hydroxymethyl)-4,17-dimethyl-5-oxo-13-phenyl-15-prop-1-en-2-yl-9,12,14,18-tetraoxahexacyclo[11.4.1.01,10.02,6.08,10.011,15]octadec-3-en-16-yl] benzoate |
|---|---|
| PubChem CID | 10099902 |
| Molecular Formula | C33H32O10 |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | [6,7-dihydroxy-8-(hydroxymethyl)-4,17-dimethyl-5-oxo-13-phenyl-15-prop-1-en-2-yl-9,12,14,18-tetraoxahexacyclo[11.4.1.01,10.02,6.08,10.011,15]octadec-3-en-16-yl] benzoate |
| SMILES | C=C(C)C12OC3(c4ccccc4)OC1C14OC1(CO)C(O)C1(O)C(=O)C(C)=CC1C4(O3)C(C)C2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C33H32O10/c1-17(2)30-24(39-25(36)20-11-7-5-8-12-20)19(4)31-22-15-18(3)23(35)29(22,38)26(37)28(16-34)32(31,41-28)27(30)40-33(42-30,43-31)21-13-9-6-10-14-21/h5-15,19,22,24,26-27,34,37-38H,1,16H2,2-4H3 |
| InChIKey | BAICBIUAUPSSDZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 144.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|