C12H15BrO3 — CID 100999144
(1S,2S,4R,5R,6R,8S,11R,12S)-5-bromo-9-(hydroxymethyl)-7-oxatetracyclo[6.4.0.02,6.04,12]dodec-9-en-11-ol (PubChem CID 100999144) has the molecular formula C12H15BrO3 and a molecular weight of 287.15 g/mol. Its IUPAC name is (1S,2S,4R,5R,6R,8S,11R,12S)-5-bromo-9-(hydroxymethyl)-7-oxatetracyclo[6.4.0.02,6.04,12]dodec-9-en-11-ol.
| Compound Name | (1S,2S,4R,5R,6R,8S,11R,12S)-5-bromo-9-(hydroxymethyl)-7-oxatetracyclo[6.4.0.02,6.04,12]dodec-9-en-11-ol |
|---|---|
| PubChem CID | 100999144 |
| Molecular Formula | C12H15BrO3 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | (1S,2S,4R,5R,6R,8S,11R,12S)-5-bromo-9-(hydroxymethyl)-7-oxatetracyclo[6.4.0.02,6.04,12]dodec-9-en-11-ol |
| SMILES | OCC1=C[C@H](O)[C@@H]2[C@H]3C[C@@H]4[C@@H](O[C@H]1[C@@H]42)[C@@H]3Br |
| InChI | InChI=1S/C12H15BrO3/c13-10-5-2-6-9-8(5)7(15)1-4(3-14)11(9)16-12(6)10/h1,5-12,14-15H,2-3H2/t5-,6+,7+,8+,9+,10-,11-,12-/m1/s1 |
| InChIKey | JWPRIIPHZVGATQ-CEDOQNOGSA-N |
| XLogP | 0.69 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|