C17H19ClN4O — CID 100999277
7-amino-6-[2-(2-chlorophenyl)ethyl-methylamino]-3,4-dihydro-1H-quinoxalin-2-one (PubChem CID 100999277) has the molecular formula C17H19ClN4O and a molecular weight of 330.82 g/mol. Its IUPAC name is 7-amino-6-[2-(2-chlorophenyl)ethyl-methylamino]-3,4-dihydro-1H-quinoxalin-2-one.
| Compound Name | 7-amino-6-[2-(2-chlorophenyl)ethyl-methylamino]-3,4-dihydro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 100999277 |
| Molecular Formula | C17H19ClN4O |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 7-amino-6-[2-(2-chlorophenyl)ethyl-methylamino]-3,4-dihydro-1H-quinoxalin-2-one |
| SMILES | CN(CCc1ccccc1Cl)c1cc2c(cc1N)NC(=O)CN2 |
| InChI | InChI=1S/C17H19ClN4O/c1-22(7-6-11-4-2-3-5-12(11)18)16-9-14-15(8-13(16)19)21-17(23)10-20-14/h2-5,8-9,20H,6-7,10,19H2,1H3,(H,21,23) |
| InChIKey | YYCFIURERFWZKZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|