C35H41F2N3OS — CID 10099937
2-(2,4-difluorophenyl)-N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylacetamide (PubChem CID 10099937) has the molecular formula C35H41F2N3OS and a molecular weight of 589.80 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylacetamide.
| Compound Name | 2-(2,4-difluorophenyl)-N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylacetamide |
|---|---|
| PubChem CID | 10099937 |
| Molecular Formula | C35H41F2N3OS |
| Molecular Weight | 589.80 g/mol |
| Exact Mass | 589.29 |
| IUPAC Name | 2-(2,4-difluorophenyl)-N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylacetamide |
| SMILES | CCCCCCCN(CCCCCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)C(=O)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C35H41F2N3OS/c1-2-3-4-5-13-22-40(32(41)25-29-20-21-30(36)26-31(29)37)23-14-8-15-24-42-35-38-33(27-16-9-6-10-17-27)34(39-35)28-18-11-7-12-19-28/h6-7,9-12,16-21,26H,2-5,8,13-15,22-25H2,1H3,(H,38,39) |
| InChIKey | GGYIIGKVCJIUOR-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.80 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|