C30H33N5O8 — CID 10099961
(2R)-2-[[(2S)-4-methyl-1-[[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]amino]-1-oxopentan-2-yl]amino]-4-(1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl)butanoic acid (PubChem CID 10099961) has the molecular formula C30H33N5O8 and a molecular weight of 591.62 g/mol. Its IUPAC name is (2R)-2-[[(2S)-4-methyl-1-[[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]amino]-1-oxopentan-2-yl]amino]-4-(1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl)butanoic acid.
| Compound Name | (2R)-2-[[(2S)-4-methyl-1-[[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]amino]-1-oxopentan-2-yl]amino]-4-(1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl)butanoic acid |
|---|---|
| PubChem CID | 10099961 |
| Molecular Formula | C30H33N5O8 |
| Molecular Weight | 591.62 g/mol |
| Exact Mass | 591.23 |
| IUPAC Name | (2R)-2-[[(2S)-4-methyl-1-[[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]amino]-1-oxopentan-2-yl]amino]-4-(1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl)butanoic acid |
| SMILES | CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)N[C@H](CCn1c(=O)c2cc3c(=O)[nH]c(=O)c3cc2c1=O)C(=O)O |
| InChI | InChI=1S/C30H33N5O8/c1-15(2)11-22(27(39)33-23(26(38)31-3)12-16-7-5-4-6-8-16)32-21(30(42)43)9-10-35-28(40)19-13-17-18(14-20(19)29(35)41)25(37)34-24(17)36/h4-8,13-15,21-23,32H,9-12H2,1-3H3,(H,31,38)(H,33,39)(H,42,43)(H,34,36,37)/t21-,22+,23+/m1/s1 |
| InChIKey | DXBIPBLPCDPKOH-VJBWXMMDSA-N |
| XLogP | -0.24 |
| TPSA | 196.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.62 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |