C20H23BrO7 — CID 101000190
[(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl (2R)-2-[(4-bromophenyl)methyl]-2-methyl-3-oxobutanoate (PubChem CID 101000190) has the molecular formula C20H23BrO7 and a molecular weight of 455.30 g/mol. Its IUPAC name is [(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl (2R)-2-[(4-bromophenyl)methyl]-2-methyl-3-oxobutanoate.
| Compound Name | [(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl (2R)-2-[(4-bromophenyl)methyl]-2-methyl-3-oxobutanoate |
|---|---|
| PubChem CID | 101000190 |
| Molecular Formula | C20H23BrO7 |
| Molecular Weight | 455.30 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | [(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl (2R)-2-[(4-bromophenyl)methyl]-2-methyl-3-oxobutanoate |
| SMILES | CC(=O)[C@@](C)(Cc1ccc(Br)cc1)C(=O)OC[C@H]1OC(=O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C20H23BrO7/c1-11(22)20(4,9-12-5-7-13(21)8-6-12)18(24)25-10-14-15-16(17(23)26-14)28-19(2,3)27-15/h5-8,14-16H,9-10H2,1-4H3/t14-,15-,16-,20-/m1/s1 |
| InChIKey | OLCCIGKWHPZYCZ-AXHMDWHKSA-N |
| XLogP | 2.58 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|