C23H29BrO7 — CID 101000196
[(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl (2R)-2-acetyl-2-[(4-bromophenyl)methyl]hexanoate (PubChem CID 101000196) has the molecular formula C23H29BrO7 and a molecular weight of 497.38 g/mol. Its IUPAC name is [(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl (2R)-2-acetyl-2-[(4-bromophenyl)methyl]hexanoate.
| Compound Name | [(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl (2R)-2-acetyl-2-[(4-bromophenyl)methyl]hexanoate |
|---|---|
| PubChem CID | 101000196 |
| Molecular Formula | C23H29BrO7 |
| Molecular Weight | 497.38 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | [(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl (2R)-2-acetyl-2-[(4-bromophenyl)methyl]hexanoate |
| SMILES | CCCC[C@@](Cc1ccc(Br)cc1)(C(C)=O)C(=O)OC[C@H]1OC(=O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C23H29BrO7/c1-5-6-11-23(14(2)25,12-15-7-9-16(24)10-8-15)21(27)28-13-17-18-19(20(26)29-17)31-22(3,4)30-18/h7-10,17-19H,5-6,11-13H2,1-4H3/t17-,18-,19-,23-/m1/s1 |
| InChIKey | UFVSSTREYRXKGQ-FZONSQQESA-N |
| XLogP | 3.75 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|