C17H16O3S — CID 101000336
3-(4-methylsulfonylphenyl)-4-phenyl-2,5-dihydrofuran (PubChem CID 101000336) has the molecular formula C17H16O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is 3-(4-methylsulfonylphenyl)-4-phenyl-2,5-dihydrofuran.
| Compound Name | 3-(4-methylsulfonylphenyl)-4-phenyl-2,5-dihydrofuran |
|---|---|
| PubChem CID | 101000336 |
| Molecular Formula | C17H16O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 3-(4-methylsulfonylphenyl)-4-phenyl-2,5-dihydrofuran |
| SMILES | CS(=O)(=O)c1ccc(C2=C(c3ccccc3)COC2)cc1 |
| InChI | InChI=1S/C17H16O3S/c1-21(18,19)15-9-7-14(8-10-15)17-12-20-11-16(17)13-5-3-2-4-6-13/h2-10H,11-12H2,1H3 |
| InChIKey | ZKFOTVQFSMRKNU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|