C14H23NO3 — CID 101000541
ethyl 2-[(3S,4S)-3-methyl-2-oxo-1-azaspiro[4.5]decan-4-yl]acetate (PubChem CID 101000541) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is ethyl 2-[(3S,4S)-3-methyl-2-oxo-1-azaspiro[4.5]decan-4-yl]acetate.
| Compound Name | ethyl 2-[(3S,4S)-3-methyl-2-oxo-1-azaspiro[4.5]decan-4-yl]acetate |
|---|---|
| PubChem CID | 101000541 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | ethyl 2-[(3S,4S)-3-methyl-2-oxo-1-azaspiro[4.5]decan-4-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1[C@H](C)C(=O)NC12CCCCC2 |
| InChI | InChI=1S/C14H23NO3/c1-3-18-12(16)9-11-10(2)13(17)15-14(11)7-5-4-6-8-14/h10-11H,3-9H2,1-2H3,(H,15,17)/t10-,11-/m0/s1 |
| InChIKey | HMQOFLAWLNTRDA-QWRGUYRKSA-N |
| XLogP | 2.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |