About 4-ethynyl-2-(4-ethynyl-1,3-thiazol-2-yl)-1,3-thiazole
4-ethynyl-2-(4-ethynyl-1,3-thiazol-2-yl)-1,3-thiazole (PubChem CID 101000714) has the molecular formula C10H4N2S2
and a molecular weight of 216.29 g/mol. Its IUPAC name is 4-ethynyl-2-(4-ethynyl-1,3-thiazol-2-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 4-ethynyl-2-(4-ethynyl-1,3-thiazol-2-yl)-1,3-thiazole |
| PubChem CID | 101000714 |
| Molecular Formula | C10H4N2S2 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 215.98 |
| IUPAC Name | 4-ethynyl-2-(4-ethynyl-1,3-thiazol-2-yl)-1,3-thiazole |
| SMILES | C#Cc1csc(-c2nc(C#C)cs2)n1 |
| InChI | InChI=1S/C10H4N2S2/c1-3-7-5-13-9(11-7)10-12-8(4-2)6-14-10/h1-2,5-6H |
| InChIKey | VNBIAVZVTCPJLG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethynyl-2-(4-ethynyl-1,3-thiazol-2-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethynyl-2-(4-ethynyl-1,3-thiazol-2-yl)-1,3-thiazole?
The IUPAC name of 4-ethynyl-2-(4-ethynyl-1,3-thiazol-2-yl)-1,3-thiazole (CID 101000714) is 4-ethynyl-2-(4-ethynyl-1,3-thiazol-2-yl)-1,3-thiazole.
What is the SMILES notation for 4-ethynyl-2-(4-ethynyl-1,3-thiazol-2-yl)-1,3-thiazole?
The canonical SMILES for 4-ethynyl-2-(4-ethynyl-1,3-thiazol-2-yl)-1,3-thiazole is C#Cc1csc(-c2nc(C#C)cs2)n1.
What is the InChIKey of 4-ethynyl-2-(4-ethynyl-1,3-thiazol-2-yl)-1,3-thiazole?
The InChIKey is VNBIAVZVTCPJLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4N2S2/c1-3-7-5-13-9(11-7)10-12-8(4-2)6-14-10/h1-2,5-6H.
What are the key properties of 4-ethynyl-2-(4-ethynyl-1,3-thiazol-2-yl)-1,3-thiazole?
4-ethynyl-2-(4-ethynyl-1,3-thiazol-2-yl)-1,3-thiazole has a molecular weight of 216.29 g/mol, XLogP of 2.23, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethynyl-2-(4-ethynyl-1,3-thiazol-2-yl)-1,3-thiazole is sourced from PubChem (CID 101000714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).