About 2,1-benzoxazol-3-yl acetate
2,1-benzoxazol-3-yl acetate (PubChem CID 101000807) has the molecular formula C9H7NO3
and a molecular weight of 177.16 g/mol. Its IUPAC name is 2,1-benzoxazol-3-yl acetate.
Molecular Properties
| Compound Name | 2,1-benzoxazol-3-yl acetate |
| PubChem CID | 101000807 |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 2,1-benzoxazol-3-yl acetate |
| SMILES | CC(=O)Oc1onc2ccccc12 |
| InChI | InChI=1S/C9H7NO3/c1-6(11)12-9-7-4-2-3-5-8(7)10-13-9/h2-5H,1H3 |
| InChIKey | GDOYCRUDLWSYFG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,1-benzoxazol-3-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,1-benzoxazol-3-yl acetate?
The IUPAC name of 2,1-benzoxazol-3-yl acetate (CID 101000807) is 2,1-benzoxazol-3-yl acetate.
What is the SMILES notation for 2,1-benzoxazol-3-yl acetate?
The canonical SMILES for 2,1-benzoxazol-3-yl acetate is CC(=O)Oc1onc2ccccc12.
What is the InChIKey of 2,1-benzoxazol-3-yl acetate?
The InChIKey is GDOYCRUDLWSYFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO3/c1-6(11)12-9-7-4-2-3-5-8(7)10-13-9/h2-5H,1H3.
What are the key properties of 2,1-benzoxazol-3-yl acetate?
2,1-benzoxazol-3-yl acetate has a molecular weight of 177.16 g/mol, XLogP of 1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,1-benzoxazol-3-yl acetate is sourced from PubChem (CID 101000807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).