C20H29NO3 — CID 101001504
[(1R,2S)-2-[(R)-deuterio(phenyl)methyl]cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 101001504) has the molecular formula C20H29NO3 and a molecular weight of 332.46 g/mol. Its IUPAC name is [(1R,2S)-2-[(R)-deuterio(phenyl)methyl]cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | [(1R,2S)-2-[(R)-deuterio(phenyl)methyl]cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 101001504 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | [(1R,2S)-2-[(R)-deuterio(phenyl)methyl]cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | [2H][C@@H](c1ccccc1)[C@@H]1CCC[C@H]1OC(=O)N1C(C)(C)COC1(C)C |
| InChI | InChI=1S/C20H29NO3/c1-19(2)14-23-20(3,4)21(19)18(22)24-17-12-8-11-16(17)13-15-9-6-5-7-10-15/h5-7,9-10,16-17H,8,11-14H2,1-4H3/t16-,17+/m0/s1/i13D/t13-,16-,17+ |
| InChIKey | MQLXSLJMMCMKNF-QAQIXVLRSA-N |
| XLogP | 4.38 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |