About (8Z)-2,2-dimethyl-1-oxa-4-azacyclododec-8-ene-5,12-dione
(8Z)-2,2-dimethyl-1-oxa-4-azacyclododec-8-ene-5,12-dione (PubChem CID 101001577) has the molecular formula C12H19NO3
and a molecular weight of 225.29 g/mol. Its IUPAC name is (8Z)-2,2-dimethyl-1-oxa-4-azacyclododec-8-ene-5,12-dione.
Molecular Properties
| Compound Name | (8Z)-2,2-dimethyl-1-oxa-4-azacyclododec-8-ene-5,12-dione |
| PubChem CID | 101001577 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | (8Z)-2,2-dimethyl-1-oxa-4-azacyclododec-8-ene-5,12-dione |
| SMILES | CC1(C)CNC(=O)CC/C=C\CCC(=O)O1 |
| InChI | InChI=1S/C12H19NO3/c1-12(2)9-13-10(14)7-5-3-4-6-8-11(15)16-12/h3-4H,5-9H2,1-2H3,(H,13,14)/b4-3- |
| InChIKey | XRDWUTBREVRRSB-ARJAWSKDSA-N |
| XLogP | 1.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (8Z)-2,2-dimethyl-1-oxa-4-azacyclododec-8-ene-5,12-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8Z)-2,2-dimethyl-1-oxa-4-azacyclododec-8-ene-5,12-dione?
The IUPAC name of (8Z)-2,2-dimethyl-1-oxa-4-azacyclododec-8-ene-5,12-dione (CID 101001577) is (8Z)-2,2-dimethyl-1-oxa-4-azacyclododec-8-ene-5,12-dione.
What is the SMILES notation for (8Z)-2,2-dimethyl-1-oxa-4-azacyclododec-8-ene-5,12-dione?
The canonical SMILES for (8Z)-2,2-dimethyl-1-oxa-4-azacyclododec-8-ene-5,12-dione is CC1(C)CNC(=O)CC/C=C\CCC(=O)O1.
What is the InChIKey of (8Z)-2,2-dimethyl-1-oxa-4-azacyclododec-8-ene-5,12-dione?
The InChIKey is XRDWUTBREVRRSB-ARJAWSKDSA-N. The full InChI is InChI=1S/C12H19NO3/c1-12(2)9-13-10(14)7-5-3-4-6-8-11(15)16-12/h3-4H,5-9H2,1-2H3,(H,13,14)/b4-3-.
What are the key properties of (8Z)-2,2-dimethyl-1-oxa-4-azacyclododec-8-ene-5,12-dione?
(8Z)-2,2-dimethyl-1-oxa-4-azacyclododec-8-ene-5,12-dione has a molecular weight of 225.29 g/mol, XLogP of 1.55, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8Z)-2,2-dimethyl-1-oxa-4-azacyclododec-8-ene-5,12-dione is sourced from PubChem (CID 101001577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).